C15H23BrO2S — CID 106734624
1-[2-(bromomethyl)-4-propan-2-ylsulfonylbutyl]-3-methylbenzene (PubChem CID 106734624) has the molecular formula C15H23BrO2S and a molecular weight of 347.32 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-4-propan-2-ylsulfonylbutyl]-3-methylbenzene.
| Compound Name | 1-[2-(bromomethyl)-4-propan-2-ylsulfonylbutyl]-3-methylbenzene |
|---|---|
| PubChem CID | 106734624 |
| Molecular Formula | C15H23BrO2S |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 1-[2-(bromomethyl)-4-propan-2-ylsulfonylbutyl]-3-methylbenzene |
| SMILES | Cc1cccc(CC(CBr)CCS(=O)(=O)C(C)C)c1 |
| InChI | InChI=1S/C15H23BrO2S/c1-12(2)19(17,18)8-7-15(11-16)10-14-6-4-5-13(3)9-14/h4-6,9,12,15H,7-8,10-11H2,1-3H3 |
| InChIKey | AGZUCDSAVFNZNZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|