C11H16O2 — CID 79001620
2-[(3-methylphenyl)methyl]propane-1,3-diol (PubChem CID 79001620) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methyl]propane-1,3-diol.
| Compound Name | 2-[(3-methylphenyl)methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 79001620 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-[(3-methylphenyl)methyl]propane-1,3-diol |
| SMILES | Cc1cccc(CC(CO)CO)c1 |
| InChI | InChI=1S/C11H16O2/c1-9-3-2-4-10(5-9)6-11(7-12)8-13/h2-5,11-13H,6-8H2,1H3 |
| InChIKey | DEQJPHPNMFHSON-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |