C16H17Br2N — CID 104813345
3-bromo-5-[2-(bromomethyl)-3-(3-methylphenyl)propyl]pyridine (PubChem CID 104813345) has the molecular formula C16H17Br2N and a molecular weight of 383.13 g/mol. Its IUPAC name is 3-bromo-5-[2-(bromomethyl)-3-(3-methylphenyl)propyl]pyridine.
| Compound Name | 3-bromo-5-[2-(bromomethyl)-3-(3-methylphenyl)propyl]pyridine |
|---|---|
| PubChem CID | 104813345 |
| Molecular Formula | C16H17Br2N |
| Molecular Weight | 383.13 g/mol |
| Exact Mass | 380.97 |
| IUPAC Name | 3-bromo-5-[2-(bromomethyl)-3-(3-methylphenyl)propyl]pyridine |
| SMILES | Cc1cccc(CC(CBr)Cc2cncc(Br)c2)c1 |
| InChI | InChI=1S/C16H17Br2N/c1-12-3-2-4-13(5-12)6-14(9-17)7-15-8-16(18)11-19-10-15/h2-5,8,10-11,14H,6-7,9H2,1H3 |
| InChIKey | PPLQMNZFFQRDDQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.13 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|