C18H19ClO4 — CID 83954789
2-(5-chloro-2-methoxyphenyl)-3-(3-ethoxyphenyl)propanoic acid (PubChem CID 83954789) has the molecular formula C18H19ClO4 and a molecular weight of 334.80 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyphenyl)-3-(3-ethoxyphenyl)propanoic acid.
| Compound Name | 2-(5-chloro-2-methoxyphenyl)-3-(3-ethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 83954789 |
| Molecular Formula | C18H19ClO4 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-(5-chloro-2-methoxyphenyl)-3-(3-ethoxyphenyl)propanoic acid |
| SMILES | CCOc1cccc(CC(C(=O)O)c2cc(Cl)ccc2OC)c1 |
| InChI | InChI=1S/C18H19ClO4/c1-3-23-14-6-4-5-12(9-14)10-16(18(20)21)15-11-13(19)7-8-17(15)22-2/h4-9,11,16H,3,10H2,1-2H3,(H,20,21) |
| InChIKey | FXHPYMCIBFVQJJ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |