C14H21NO4 — CID 58545613
tert-butyl 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate (PubChem CID 58545613) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is tert-butyl 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate.
| Compound Name | tert-butyl 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 58545613 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | tert-butyl 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate |
| SMILES | COc1cc(CC(N)C(=O)OC(C)(C)C)ccc1O |
| InChI | InChI=1S/C14H21NO4/c1-14(2,3)19-13(17)10(15)7-9-5-6-11(16)12(8-9)18-4/h5-6,8,10,16H,7,15H2,1-4H3 |
| InChIKey | QVNRMFXOFXPAGW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |