C17H20ClNO4 — CID 70209453
benzyl 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate;hydrochloride (PubChem CID 70209453) has the molecular formula C17H20ClNO4 and a molecular weight of 337.80 g/mol. Its IUPAC name is benzyl 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate;hydrochloride.
| Compound Name | benzyl 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 70209453 |
| Molecular Formula | C17H20ClNO4 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | benzyl 2-amino-3-(4-hydroxy-3-methoxyphenyl)propanoate;hydrochloride |
| SMILES | COc1cc(CC(N)C(=O)OCc2ccccc2)ccc1O.Cl |
| InChI | InChI=1S/C17H19NO4.ClH/c1-21-16-10-13(7-8-15(16)19)9-14(18)17(20)22-11-12-5-3-2-4-6-12;/h2-8,10,14,19H,9,11,18H2,1H3;1H |
| InChIKey | GOOLLOIBZFIWPG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |