About benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride
benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride (PubChem CID 139716246) has the molecular formula C17H20ClNO2
and a molecular weight of 305.81 g/mol. Its IUPAC name is benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride.
Molecular Properties
| Compound Name | benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride |
| PubChem CID | 139716246 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride |
| SMILES | Cc1ccc(C[C@H](N)C(=O)OCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C17H19NO2.ClH/c1-13-7-9-14(10-8-13)11-16(18)17(19)20-12-15-5-3-2-4-6-15;/h2-10,16H,11-12,18H2,1H3;1H/t16-;/m0./s1 |
| InChIKey | YUPZQHCYMIHIKN-NTISSMGPSA-N |
| XLogP | 3.03 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride?
The IUPAC name of benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride (CID 139716246) is benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride.
What is the SMILES notation for benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride?
The canonical SMILES for benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride is Cc1ccc(C[C@H](N)C(=O)OCc2ccccc2)cc1.Cl.
What is the InChIKey of benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride?
The InChIKey is YUPZQHCYMIHIKN-NTISSMGPSA-N. The full InChI is InChI=1S/C17H19NO2.ClH/c1-13-7-9-14(10-8-13)11-16(18)17(19)20-12-15-5-3-2-4-6-15;/h2-10,16H,11-12,18H2,1H3;1H/t16-;/m0./s1.
What are the key properties of benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride?
benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride has a molecular weight of 305.81 g/mol, XLogP of 3.03, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S)-2-amino-3-(4-methylphenyl)propanoate;hydrochloride is sourced from PubChem (CID 139716246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).