C23H22N2O4 — CID 140972964
benzyl (2S)-2-amino-3-[4-(4-methylphenyl)-3-nitrophenyl]propanoate (PubChem CID 140972964) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is benzyl (2S)-2-amino-3-[4-(4-methylphenyl)-3-nitrophenyl]propanoate.
| Compound Name | benzyl (2S)-2-amino-3-[4-(4-methylphenyl)-3-nitrophenyl]propanoate |
|---|---|
| PubChem CID | 140972964 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | benzyl (2S)-2-amino-3-[4-(4-methylphenyl)-3-nitrophenyl]propanoate |
| SMILES | Cc1ccc(-c2ccc(C[C@H](N)C(=O)OCc3ccccc3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H22N2O4/c1-16-7-10-19(11-8-16)20-12-9-18(14-22(20)25(27)28)13-21(24)23(26)29-15-17-5-3-2-4-6-17/h2-12,14,21H,13,15,24H2,1H3/t21-/m0/s1 |
| InChIKey | UTHYMOYFHPMPHO-NRFANRHFSA-N |
| XLogP | 4.18 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|