C16H23N3O4 — CID 170884816
ethyl 2-amino-3-(3-nitro-4-piperidin-1-ylphenyl)propanoate (PubChem CID 170884816) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is ethyl 2-amino-3-(3-nitro-4-piperidin-1-ylphenyl)propanoate.
| Compound Name | ethyl 2-amino-3-(3-nitro-4-piperidin-1-ylphenyl)propanoate |
|---|---|
| PubChem CID | 170884816 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | ethyl 2-amino-3-(3-nitro-4-piperidin-1-ylphenyl)propanoate |
| SMILES | CCOC(=O)C(N)Cc1ccc(N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H23N3O4/c1-2-23-16(20)13(17)10-12-6-7-14(15(11-12)19(21)22)18-8-4-3-5-9-18/h6-7,11,13H,2-5,8-10,17H2,1H3 |
| InChIKey | DSMGHZCKTHSVQR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|