C13H18N4O3 — CID 98021669
1-[4-[4-(aminomethyl)-2-nitrophenyl]piperazin-1-yl]ethanone (PubChem CID 98021669) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 1-[4-[4-(aminomethyl)-2-nitrophenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-(aminomethyl)-2-nitrophenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 98021669 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 1-[4-[4-(aminomethyl)-2-nitrophenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(CN)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H18N4O3/c1-10(18)15-4-6-16(7-5-15)12-3-2-11(9-14)8-13(12)17(19)20/h2-3,8H,4-7,9,14H2,1H3 |
| InChIKey | VXYSFDRWDIUXCP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|