C19H30ClN5O4 — CID 119569280
4-(4-acetylpiperazin-1-yl)-N-[3-(aminomethyl)pentan-3-yl]-3-nitrobenzamide;hydrochloride (PubChem CID 119569280) has the molecular formula C19H30ClN5O4 and a molecular weight of 427.93 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-N-[3-(aminomethyl)pentan-3-yl]-3-nitrobenzamide;hydrochloride.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-N-[3-(aminomethyl)pentan-3-yl]-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119569280 |
| Molecular Formula | C19H30ClN5O4 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-N-[3-(aminomethyl)pentan-3-yl]-3-nitrobenzamide;hydrochloride |
| SMILES | CCC(CC)(CN)NC(=O)c1ccc(N2CCN(C(C)=O)CC2)c([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C19H29N5O4.ClH/c1-4-19(5-2,13-20)21-18(26)15-6-7-16(17(12-15)24(27)28)23-10-8-22(9-11-23)14(3)25;/h6-7,12H,4-5,8-11,13,20H2,1-3H3,(H,21,26);1H |
| InChIKey | LQSXBNVTACWFMJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|