C19H29N5O4 — CID 119606137
4-(4-acetylpiperazin-1-yl)-N-(1-amino-2,3-dimethylbutan-2-yl)-3-nitrobenzamide (PubChem CID 119606137) has the molecular formula C19H29N5O4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-N-(1-amino-2,3-dimethylbutan-2-yl)-3-nitrobenzamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-N-(1-amino-2,3-dimethylbutan-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 119606137 |
| Molecular Formula | C19H29N5O4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-N-(1-amino-2,3-dimethylbutan-2-yl)-3-nitrobenzamide |
| SMILES | CC(=O)N1CCN(c2ccc(C(=O)NC(C)(CN)C(C)C)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H29N5O4/c1-13(2)19(4,12-20)21-18(26)15-5-6-16(17(11-15)24(27)28)23-9-7-22(8-10-23)14(3)25/h5-6,11,13H,7-10,12,20H2,1-4H3,(H,21,26) |
| InChIKey | RVPPUVVPXSGRRR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|