C19H29N5O4 — CID 119653269
4-(4-acetylpiperazin-1-yl)-N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-nitrobenzamide (PubChem CID 119653269) has the molecular formula C19H29N5O4 and a molecular weight of 391.47 g/mol. Its IUPAC name is 4-(4-acetylpiperazin-1-yl)-N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-nitrobenzamide.
| Compound Name | 4-(4-acetylpiperazin-1-yl)-N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 119653269 |
| Molecular Formula | C19H29N5O4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.22 |
| IUPAC Name | 4-(4-acetylpiperazin-1-yl)-N-(3-amino-2,2-dimethylpropyl)-N-methyl-3-nitrobenzamide |
| SMILES | CC(=O)N1CCN(c2ccc(C(=O)N(C)CC(C)(C)CN)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C19H29N5O4/c1-14(25)22-7-9-23(10-8-22)16-6-5-15(11-17(16)24(27)28)18(26)21(4)13-19(2,3)12-20/h5-6,11H,7-10,12-13,20H2,1-4H3 |
| InChIKey | HPMSDDXVXBAXNR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|