C16H21N3O5 — CID 119228109
2-methyl-3-[methyl-(3-nitro-4-pyrrolidin-1-ylbenzoyl)amino]propanoic acid (PubChem CID 119228109) has the molecular formula C16H21N3O5 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-methyl-3-[methyl-(3-nitro-4-pyrrolidin-1-ylbenzoyl)amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-(3-nitro-4-pyrrolidin-1-ylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119228109 |
| Molecular Formula | C16H21N3O5 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 2-methyl-3-[methyl-(3-nitro-4-pyrrolidin-1-ylbenzoyl)amino]propanoic acid |
| SMILES | CC(CN(C)C(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C16H21N3O5/c1-11(16(21)22)10-17(2)15(20)12-5-6-13(14(9-12)19(23)24)18-7-3-4-8-18/h5-6,9,11H,3-4,7-8,10H2,1-2H3,(H,21,22) |
| InChIKey | YDTSYJQXESMMPU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|