C17H21N3O5 — CID 119202612
2-[cyclopropyl-(3-nitro-4-pyrrolidin-1-ylbenzoyl)amino]propanoic acid (PubChem CID 119202612) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is 2-[cyclopropyl-(3-nitro-4-pyrrolidin-1-ylbenzoyl)amino]propanoic acid.
| Compound Name | 2-[cyclopropyl-(3-nitro-4-pyrrolidin-1-ylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 119202612 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[cyclopropyl-(3-nitro-4-pyrrolidin-1-ylbenzoyl)amino]propanoic acid |
| SMILES | CC(C(=O)O)N(C(=O)c1ccc(N2CCCC2)c([N+](=O)[O-])c1)C1CC1 |
| InChI | InChI=1S/C17H21N3O5/c1-11(17(22)23)19(13-5-6-13)16(21)12-4-7-14(15(10-12)20(24)25)18-8-2-3-9-18/h4,7,10-11,13H,2-3,5-6,8-9H2,1H3,(H,22,23) |
| InChIKey | XMJSFRPYOIGMFP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|