C21H29N3O3 — CID 55594956
N-cyclopropyl-N-(4-methylcyclohexyl)-3-nitro-4-pyrrolidin-1-ylbenzamide (PubChem CID 55594956) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is N-cyclopropyl-N-(4-methylcyclohexyl)-3-nitro-4-pyrrolidin-1-ylbenzamide.
| Compound Name | N-cyclopropyl-N-(4-methylcyclohexyl)-3-nitro-4-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 55594956 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | N-cyclopropyl-N-(4-methylcyclohexyl)-3-nitro-4-pyrrolidin-1-ylbenzamide |
| SMILES | CC1CCC(N(C(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)C2CC2)CC1 |
| InChI | InChI=1S/C21H29N3O3/c1-15-4-7-17(8-5-15)23(18-9-10-18)21(25)16-6-11-19(20(14-16)24(26)27)22-12-2-3-13-22/h6,11,14-15,17-18H,2-5,7-10,12-13H2,1H3 |
| InChIKey | ZTVPEEJSTVKBMM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|