C14H18N2O4 — CID 63624097
4-(4-methylazepan-1-yl)-3-nitrobenzoic acid (PubChem CID 63624097) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-(4-methylazepan-1-yl)-3-nitrobenzoic acid.
| Compound Name | 4-(4-methylazepan-1-yl)-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 63624097 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-(4-methylazepan-1-yl)-3-nitrobenzoic acid |
| SMILES | CC1CCCN(c2ccc(C(=O)O)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H18N2O4/c1-10-3-2-7-15(8-6-10)12-5-4-11(14(17)18)9-13(12)16(19)20/h4-5,9-10H,2-3,6-8H2,1H3,(H,17,18) |
| InChIKey | GSRYGNFVSJEALA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|