C20H27N3O5 — CID 122114674
(2S,3S)-2-methyl-1-[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]piperidine-3-carboxylic acid (PubChem CID 122114674) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is (2S,3S)-2-methyl-1-[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]piperidine-3-carboxylic acid.
| Compound Name | (2S,3S)-2-methyl-1-[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122114674 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (2S,3S)-2-methyl-1-[4-(4-methylpiperidin-1-yl)-3-nitrobenzoyl]piperidine-3-carboxylic acid |
| SMILES | CC1CCN(c2ccc(C(=O)N3CCC[C@H](C(=O)O)[C@@H]3C)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H27N3O5/c1-13-7-10-21(11-8-13)17-6-5-15(12-18(17)23(27)28)19(24)22-9-3-4-16(14(22)2)20(25)26/h5-6,12-14,16H,3-4,7-11H2,1-2H3,(H,25,26)/t14-,16-/m0/s1 |
| InChIKey | LVNUHCLJQLDCMP-HOCLYGCPSA-N |
| XLogP | 3.16 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|