C22H26N4O3 — CID 25415500
[4-(4-methylpiperidin-1-yl)-3-nitrophenyl]-[(2S)-2-pyridin-3-ylpyrrolidin-1-yl]methanone (PubChem CID 25415500) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is [4-(4-methylpiperidin-1-yl)-3-nitrophenyl]-[(2S)-2-pyridin-3-ylpyrrolidin-1-yl]methanone.
| Compound Name | [4-(4-methylpiperidin-1-yl)-3-nitrophenyl]-[(2S)-2-pyridin-3-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 25415500 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [4-(4-methylpiperidin-1-yl)-3-nitrophenyl]-[(2S)-2-pyridin-3-ylpyrrolidin-1-yl]methanone |
| SMILES | CC1CCN(c2ccc(C(=O)N3CCC[C@H]3c3cccnc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C22H26N4O3/c1-16-8-12-24(13-9-16)20-7-6-17(14-21(20)26(28)29)22(27)25-11-3-5-19(25)18-4-2-10-23-15-18/h2,4,6-7,10,14-16,19H,3,5,8-9,11-13H2,1H3/t19-/m0/s1 |
| InChIKey | AKQOUSDDGCFHRQ-IBGZPJMESA-N |
| XLogP | 4.20 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|