C18H20N2O3 — CID 110867000
(3,5-dimethoxyphenyl)-(2-pyridin-3-ylpyrrolidin-1-yl)methanone (PubChem CID 110867000) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl)-(2-pyridin-3-ylpyrrolidin-1-yl)methanone.
| Compound Name | (3,5-dimethoxyphenyl)-(2-pyridin-3-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 110867000 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (3,5-dimethoxyphenyl)-(2-pyridin-3-ylpyrrolidin-1-yl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)N2CCCC2c2cccnc2)c1 |
| InChI | InChI=1S/C18H20N2O3/c1-22-15-9-14(10-16(11-15)23-2)18(21)20-8-4-6-17(20)13-5-3-7-19-12-13/h3,5,7,9-12,17H,4,6,8H2,1-2H3 |
| InChIKey | JRJIBMZNSXCIQM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |