C20H23N3O3S — CID 3808385
3,5-dimethoxy-N-(2-pyridin-3-ylpiperidine-1-carbothioyl)benzamide (PubChem CID 3808385) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 3,5-dimethoxy-N-(2-pyridin-3-ylpiperidine-1-carbothioyl)benzamide.
| Compound Name | 3,5-dimethoxy-N-(2-pyridin-3-ylpiperidine-1-carbothioyl)benzamide |
|---|---|
| PubChem CID | 3808385 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 3,5-dimethoxy-N-(2-pyridin-3-ylpiperidine-1-carbothioyl)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(=S)N2CCCCC2c2cccnc2)c1 |
| InChI | InChI=1S/C20H23N3O3S/c1-25-16-10-15(11-17(12-16)26-2)19(24)22-20(27)23-9-4-3-7-18(23)14-6-5-8-21-13-14/h5-6,8,10-13,18H,3-4,7,9H2,1-2H3,(H,22,24,27) |
| InChIKey | LSNOHYQIJSBYPH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|