C20H21FN2OS — CID 146610457
4-fluoro-N-[2-(3-methylphenyl)piperidine-1-carbothioyl]benzamide (PubChem CID 146610457) has the molecular formula C20H21FN2OS and a molecular weight of 356.47 g/mol. Its IUPAC name is 4-fluoro-N-[2-(3-methylphenyl)piperidine-1-carbothioyl]benzamide.
| Compound Name | 4-fluoro-N-[2-(3-methylphenyl)piperidine-1-carbothioyl]benzamide |
|---|---|
| PubChem CID | 146610457 |
| Molecular Formula | C20H21FN2OS |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-fluoro-N-[2-(3-methylphenyl)piperidine-1-carbothioyl]benzamide |
| SMILES | Cc1cccc(C2CCCCN2C(=S)NC(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H21FN2OS/c1-14-5-4-6-16(13-14)18-7-2-3-12-23(18)20(25)22-19(24)15-8-10-17(21)11-9-15/h4-6,8-11,13,18H,2-3,7,12H2,1H3,(H,22,24,25) |
| InChIKey | MAIFOYBMWBXFKE-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|