C19H18F3N3OS — CID 146611635
N-(2-pyridin-3-ylpiperidine-1-carbothioyl)-4-(trifluoromethyl)benzamide (PubChem CID 146611635) has the molecular formula C19H18F3N3OS and a molecular weight of 393.43 g/mol. Its IUPAC name is N-(2-pyridin-3-ylpiperidine-1-carbothioyl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(2-pyridin-3-ylpiperidine-1-carbothioyl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 146611635 |
| Molecular Formula | C19H18F3N3OS |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-(2-pyridin-3-ylpiperidine-1-carbothioyl)-4-(trifluoromethyl)benzamide |
| SMILES | O=C(NC(=S)N1CCCCC1c1cccnc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H18F3N3OS/c20-19(21,22)15-8-6-13(7-9-15)17(26)24-18(27)25-11-2-1-5-16(25)14-4-3-10-23-12-14/h3-4,6-10,12,16H,1-2,5,11H2,(H,24,26,27) |
| InChIKey | XXSHDAAJKPJFPU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|