C14H19ClN2O3 — CID 52993705
4-oxo-4-(2-pyridin-3-ylpiperidin-1-yl)butanoic acid;hydrochloride (PubChem CID 52993705) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is 4-oxo-4-(2-pyridin-3-ylpiperidin-1-yl)butanoic acid;hydrochloride.
| Compound Name | 4-oxo-4-(2-pyridin-3-ylpiperidin-1-yl)butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 52993705 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-oxo-4-(2-pyridin-3-ylpiperidin-1-yl)butanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCC(=O)N1CCCCC1c1cccnc1 |
| InChI | InChI=1S/C14H18N2O3.ClH/c17-13(6-7-14(18)19)16-9-2-1-5-12(16)11-4-3-8-15-10-11;/h3-4,8,10,12H,1-2,5-7,9H2,(H,18,19);1H |
| InChIKey | GRPUBLQWYRZBIB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |