C18H22ClN3O — CID 120613570
3-(2-aminophenyl)-1-(2-pyridin-3-ylpyrrolidin-1-yl)propan-1-one;hydrochloride (PubChem CID 120613570) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-(2-pyridin-3-ylpyrrolidin-1-yl)propan-1-one;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-1-(2-pyridin-3-ylpyrrolidin-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120613570 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 3-(2-aminophenyl)-1-(2-pyridin-3-ylpyrrolidin-1-yl)propan-1-one;hydrochloride |
| SMILES | Cl.Nc1ccccc1CCC(=O)N1CCCC1c1cccnc1 |
| InChI | InChI=1S/C18H21N3O.ClH/c19-16-7-2-1-5-14(16)9-10-18(22)21-12-4-8-17(21)15-6-3-11-20-13-15;/h1-3,5-7,11,13,17H,4,8-10,12,19H2;1H |
| InChIKey | MNBHUCJNVCMZLH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|