C21H29Cl2N3O — CID 120613264
3-(2-aminophenyl)-1-[2-[3-(dimethylamino)phenyl]pyrrolidin-1-yl]propan-1-one;dihydrochloride (PubChem CID 120613264) has the molecular formula C21H29Cl2N3O and a molecular weight of 410.39 g/mol. Its IUPAC name is 3-(2-aminophenyl)-1-[2-[3-(dimethylamino)phenyl]pyrrolidin-1-yl]propan-1-one;dihydrochloride.
| Compound Name | 3-(2-aminophenyl)-1-[2-[3-(dimethylamino)phenyl]pyrrolidin-1-yl]propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 120613264 |
| Molecular Formula | C21H29Cl2N3O |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 3-(2-aminophenyl)-1-[2-[3-(dimethylamino)phenyl]pyrrolidin-1-yl]propan-1-one;dihydrochloride |
| SMILES | CN(C)c1cccc(C2CCCN2C(=O)CCc2ccccc2N)c1.Cl.Cl |
| InChI | InChI=1S/C21H27N3O.2ClH/c1-23(2)18-9-5-8-17(15-18)20-11-6-14-24(20)21(25)13-12-16-7-3-4-10-19(16)22;;/h3-5,7-10,15,20H,6,11-14,22H2,1-2H3;2*1H |
| InChIKey | ICKZYWTUQTWQAU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|