C20H27Cl2N3O — CID 119889816
2-(4-aminophenyl)-1-[2-[3-(dimethylamino)phenyl]pyrrolidin-1-yl]ethanone;dihydrochloride (PubChem CID 119889816) has the molecular formula C20H27Cl2N3O and a molecular weight of 396.36 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[2-[3-(dimethylamino)phenyl]pyrrolidin-1-yl]ethanone;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-1-[2-[3-(dimethylamino)phenyl]pyrrolidin-1-yl]ethanone;dihydrochloride |
|---|---|
| PubChem CID | 119889816 |
| Molecular Formula | C20H27Cl2N3O |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 2-(4-aminophenyl)-1-[2-[3-(dimethylamino)phenyl]pyrrolidin-1-yl]ethanone;dihydrochloride |
| SMILES | CN(C)c1cccc(C2CCCN2C(=O)Cc2ccc(N)cc2)c1.Cl.Cl |
| InChI | InChI=1S/C20H25N3O.2ClH/c1-22(2)18-6-3-5-16(14-18)19-7-4-12-23(19)20(24)13-15-8-10-17(21)11-9-15;;/h3,5-6,8-11,14,19H,4,7,12-13,21H2,1-2H3;2*1H |
| InChIKey | IYSMSUVVIFODFI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|