C17H26N2O — CID 99698262
2-(4-aminophenyl)-1-[(2S)-2-(2,2-dimethylpropyl)pyrrolidin-1-yl]ethanone (PubChem CID 99698262) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[(2S)-2-(2,2-dimethylpropyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(4-aminophenyl)-1-[(2S)-2-(2,2-dimethylpropyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 99698262 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 2-(4-aminophenyl)-1-[(2S)-2-(2,2-dimethylpropyl)pyrrolidin-1-yl]ethanone |
| SMILES | CC(C)(C)C[C@@H]1CCCN1C(=O)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C17H26N2O/c1-17(2,3)12-15-5-4-10-19(15)16(20)11-13-6-8-14(18)9-7-13/h6-9,15H,4-5,10-12,18H2,1-3H3/t15-/m0/s1 |
| InChIKey | OLQWWENLJJXLTQ-HNNXBMFYSA-N |
| XLogP | 3.24 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|