C18H19BrN4OS — CID 3793812
4-bromo-N-[(2-pyridin-3-ylpiperidin-1-yl)carbamothioyl]benzamide (PubChem CID 3793812) has the molecular formula C18H19BrN4OS and a molecular weight of 419.35 g/mol. Its IUPAC name is 4-bromo-N-[(2-pyridin-3-ylpiperidin-1-yl)carbamothioyl]benzamide.
| Compound Name | 4-bromo-N-[(2-pyridin-3-ylpiperidin-1-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3793812 |
| Molecular Formula | C18H19BrN4OS |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | 4-bromo-N-[(2-pyridin-3-ylpiperidin-1-yl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)NN1CCCCC1c1cccnc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H19BrN4OS/c19-15-8-6-13(7-9-15)17(24)21-18(25)22-23-11-2-1-5-16(23)14-4-3-10-20-12-14/h3-4,6-10,12,16H,1-2,5,11H2,(H2,21,22,24,25) |
| InChIKey | QXYNUQHGZFHXKK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|