C10H14N2OZn — CID 157051312
zinc;3-(1-methylpyrrolidin-2-yl)pyridine;oxygen(2-) (PubChem CID 157051312) has the molecular formula C10H14N2OZn and a molecular weight of 243.62 g/mol. Its IUPAC name is zinc;3-(1-methylpyrrolidin-2-yl)pyridine;oxygen(2-).
| Compound Name | zinc;3-(1-methylpyrrolidin-2-yl)pyridine;oxygen(2-) |
|---|---|
| PubChem CID | 157051312 |
| Molecular Formula | C10H14N2OZn |
| Molecular Weight | 243.62 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | zinc;3-(1-methylpyrrolidin-2-yl)pyridine;oxygen(2-) |
| SMILES | CN1CCCC1c1cccnc1.[O-2].[Zn+2] |
| InChI | InChI=1S/C10H14N2.O.Zn/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;;/h2,4,6,8,10H,3,5,7H2,1H3;;/q;-2;+2 |
| InChIKey | AAFWNJSLLASJKB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 44.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.62 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|