C13H22N2 — CID 91386217
3-(1-methylpyrrolidin-2-yl)pyridine;propane (PubChem CID 91386217) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 3-(1-methylpyrrolidin-2-yl)pyridine;propane.
| Compound Name | 3-(1-methylpyrrolidin-2-yl)pyridine;propane |
|---|---|
| PubChem CID | 91386217 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 3-(1-methylpyrrolidin-2-yl)pyridine;propane |
| SMILES | CCC.CN1CCCC1c1cccnc1 |
| InChI | InChI=1S/C10H14N2.C3H8/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;1-3-2/h2,4,6,8,10H,3,5,7H2,1H3;3H2,1-2H3 |
| InChIKey | RWBWMKFVHXEGQK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |