C11H18N2O — CID 174330723
methanol;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine (PubChem CID 174330723) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is methanol;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine.
| Compound Name | methanol;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 174330723 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | methanol;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| SMILES | CN1CCC[C@H]1c1cccnc1.CO |
| InChI | InChI=1S/C10H14N2.CH4O/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;1-2/h2,4,6,8,10H,3,5,7H2,1H3;2H,1H3/t10-;/m0./s1 |
| InChIKey | MSCNUQCEEQKVCO-PPHPATTJSA-N |
| XLogP | 1.46 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |