C20H29N4+ — CID 158783488
hydron;bis(3-(1-methylpyrrolidin-2-yl)pyridine) (PubChem CID 158783488) has the molecular formula C20H29N4+ and a molecular weight of 325.48 g/mol. Its IUPAC name is hydron;bis(3-(1-methylpyrrolidin-2-yl)pyridine).
| Compound Name | hydron;bis(3-(1-methylpyrrolidin-2-yl)pyridine) |
|---|---|
| PubChem CID | 158783488 |
| Molecular Formula | C20H29N4+ |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | hydron;bis(3-(1-methylpyrrolidin-2-yl)pyridine) |
| SMILES | CN1CCCC1c1cccnc1.CN1CCCC1c1cccnc1.[H+] |
| InChI | InChI=1S/2C10H14N2/c2*1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2*2,4,6,8,10H,3,5,7H2,1H3/p+1 |
| InChIKey | IRJNJBIOUYJBHG-UHFFFAOYSA-O |
| XLogP | 3.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |