C14H26N2 — CID 144528341
ethane;3-(1-methylpyrrolidin-2-yl)pyridine (PubChem CID 144528341) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is ethane;3-(1-methylpyrrolidin-2-yl)pyridine.
| Compound Name | ethane;3-(1-methylpyrrolidin-2-yl)pyridine |
|---|---|
| PubChem CID | 144528341 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | ethane;3-(1-methylpyrrolidin-2-yl)pyridine |
| SMILES | CC.CC.CN1CCCC1c1cccnc1 |
| InChI | InChI=1S/C10H14N2.2C2H6/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;2*1-2/h2,4,6,8,10H,3,5,7H2,1H3;2*1-2H3 |
| InChIKey | YVPUDYRAEBRPDY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |