C10H14N2Zn — CID 67468212
3-(1-methylpyrrolidin-2-yl)pyridine;zinc (PubChem CID 67468212) has the molecular formula C10H14N2Zn and a molecular weight of 227.63 g/mol. Its IUPAC name is 3-(1-methylpyrrolidin-2-yl)pyridine;zinc.
| Compound Name | 3-(1-methylpyrrolidin-2-yl)pyridine;zinc |
|---|---|
| PubChem CID | 67468212 |
| Molecular Formula | C10H14N2Zn |
| Molecular Weight | 227.63 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 3-(1-methylpyrrolidin-2-yl)pyridine;zinc |
| SMILES | CN1CCCC1c1cccnc1.[Zn] |
| InChI | InChI=1S/C10H14N2.Zn/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;/h2,4,6,8,10H,3,5,7H2,1H3; |
| InChIKey | ZGARFQMRHGRMAT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.63 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|