C10H14N2Sn — CID 159245541
CID 159245541 (PubChem CID 159245541) has the molecular formula C10H14N2Sn and a molecular weight of 280.95 g/mol.
| Compound Name | CID 159245541 |
|---|---|
| PubChem CID | 159245541 |
| Molecular Formula | C10H14N2Sn |
| Molecular Weight | 280.95 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | — |
| SMILES | CN1CCCC1c1cccnc1.[Sn] |
| InChI | InChI=1S/C10H14N2.Sn/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;/h2,4,6,8,10H,3,5,7H2,1H3; |
| InChIKey | KUQDGVANJNUZJQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.95 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |