C11H14CuN3 — CID 21152440
copper(1+);3-[(2S)-1-methylpyrrolidin-2-yl]pyridine;cyanide (PubChem CID 21152440) has the molecular formula C11H14CuN3 and a molecular weight of 251.80 g/mol. Its IUPAC name is copper(1+);3-[(2S)-1-methylpyrrolidin-2-yl]pyridine;cyanide.
| Compound Name | copper(1+);3-[(2S)-1-methylpyrrolidin-2-yl]pyridine;cyanide |
|---|---|
| PubChem CID | 21152440 |
| Molecular Formula | C11H14CuN3 |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | copper(1+);3-[(2S)-1-methylpyrrolidin-2-yl]pyridine;cyanide |
| SMILES | CN1CCC[C@H]1c1cccnc1.[C-]#N.[Cu+] |
| InChI | InChI=1S/C10H14N2.CN.Cu/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;1-2;/h2,4,6,8,10H,3,5,7H2,1H3;;/q;-1;+1/t10-;;/m0../s1 |
| InChIKey | FBSAWNZJKFXVPF-XRIOVQLTSA-N |
| XLogP | 1.94 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|