C14H18N2O8 — CID 159143425
3-(1-methylpyrrolidin-2-yl)pyridine;oxalic acid (PubChem CID 159143425) has the molecular formula C14H18N2O8 and a molecular weight of 342.30 g/mol. Its IUPAC name is 3-(1-methylpyrrolidin-2-yl)pyridine;oxalic acid.
| Compound Name | 3-(1-methylpyrrolidin-2-yl)pyridine;oxalic acid |
|---|---|
| PubChem CID | 159143425 |
| Molecular Formula | C14H18N2O8 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 3-(1-methylpyrrolidin-2-yl)pyridine;oxalic acid |
| SMILES | CN1CCCC1c1cccnc1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H14N2.2C2H2O4/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;2*3-1(4)2(5)6/h2,4,6,8,10H,3,5,7H2,1H3;2*(H,3,4)(H,5,6) |
| InChIKey | KIJMHJOKXPEMPI-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 165.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|