C10H14N2 — CID 11126596
3-(1-methyl(115N)azolidin-2-yl)pyridine (PubChem CID 11126596) has the molecular formula C10H14N2 and a molecular weight of 163.23 g/mol. Its IUPAC name is 3-(1-methyl(115N)azolidin-2-yl)pyridine.
| Compound Name | 3-(1-methyl(115N)azolidin-2-yl)pyridine |
|---|---|
| PubChem CID | 11126596 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 163.23 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 3-(1-methyl(115N)azolidin-2-yl)pyridine |
| SMILES | C[15N]1CCCC1c1cccnc1 |
| InChI | InChI=1S/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/i12+1 |
| InChIKey | SNICXCGAKADSCV-HNHCFKFXSA-N |
| XLogP | 1.85 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.23 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |