C14H26N4 — CID 174745623
butane-1,4-diamine;3-(1-methylpyrrolidin-2-yl)pyridine (PubChem CID 174745623) has the molecular formula C14H26N4 and a molecular weight of 250.39 g/mol. Its IUPAC name is butane-1,4-diamine;3-(1-methylpyrrolidin-2-yl)pyridine.
| Compound Name | butane-1,4-diamine;3-(1-methylpyrrolidin-2-yl)pyridine |
|---|---|
| PubChem CID | 174745623 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | butane-1,4-diamine;3-(1-methylpyrrolidin-2-yl)pyridine |
| SMILES | CN1CCCC1c1cccnc1.NCCCCN |
| InChI | InChI=1S/C10H14N2.C4H12N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;5-3-1-2-4-6/h2,4,6,8,10H,3,5,7H2,1H3;1-6H2 |
| InChIKey | WFXQHIMHWYLNRJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|