C11H17N3O — CID 175000566
formamide;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine (PubChem CID 175000566) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is formamide;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine.
| Compound Name | formamide;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
|---|---|
| PubChem CID | 175000566 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | formamide;3-[(2S)-1-methylpyrrolidin-2-yl]pyridine |
| SMILES | CN1CCC[C@H]1c1cccnc1.NC=O |
| InChI | InChI=1S/C10H14N2.CH3NO/c1-12-7-3-5-10(12)9-4-2-6-11-8-9;2-1-3/h2,4,6,8,10H,3,5,7H2,1H3;1H,(H2,2,3)/t10-;/m0./s1 |
| InChIKey | PAKSWDSHXMEOMS-PPHPATTJSA-N |
| XLogP | 0.95 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|