C20H23FN2O — CID 93076892
(2S)-N-(3-fluorophenyl)-2-(3-methylphenyl)azepane-1-carboxamide (PubChem CID 93076892) has the molecular formula C20H23FN2O and a molecular weight of 326.42 g/mol. Its IUPAC name is (2S)-N-(3-fluorophenyl)-2-(3-methylphenyl)azepane-1-carboxamide.
| Compound Name | (2S)-N-(3-fluorophenyl)-2-(3-methylphenyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 93076892 |
| Molecular Formula | C20H23FN2O |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (2S)-N-(3-fluorophenyl)-2-(3-methylphenyl)azepane-1-carboxamide |
| SMILES | Cc1cccc([C@@H]2CCCCCN2C(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C20H23FN2O/c1-15-7-5-8-16(13-15)19-11-3-2-4-12-23(19)20(24)22-18-10-6-9-17(21)14-18/h5-10,13-14,19H,2-4,11-12H2,1H3,(H,22,24)/t19-/m0/s1 |
| InChIKey | ASZZVASAIXTTLV-IBGZPJMESA-N |
| XLogP | 5.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |