C19H20FN3O3 — CID 87035285
methyl N-[3-[[2-(3-fluorophenyl)pyrrolidine-1-carbonyl]amino]phenyl]carbamate (PubChem CID 87035285) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is methyl N-[3-[[2-(3-fluorophenyl)pyrrolidine-1-carbonyl]amino]phenyl]carbamate.
| Compound Name | methyl N-[3-[[2-(3-fluorophenyl)pyrrolidine-1-carbonyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 87035285 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | methyl N-[3-[[2-(3-fluorophenyl)pyrrolidine-1-carbonyl]amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1cccc(NC(=O)N2CCCC2c2cccc(F)c2)c1 |
| InChI | InChI=1S/C19H20FN3O3/c1-26-19(25)22-16-8-3-7-15(12-16)21-18(24)23-10-4-9-17(23)13-5-2-6-14(20)11-13/h2-3,5-8,11-12,17H,4,9-10H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | OQIJHFFHGAYPTG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |