C17H17FN2O3S — CID 51694845
methyl 3-[[(2S)-2-(3-fluorophenyl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate (PubChem CID 51694845) has the molecular formula C17H17FN2O3S and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 3-[[(2S)-2-(3-fluorophenyl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[(2S)-2-(3-fluorophenyl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 51694845 |
| Molecular Formula | C17H17FN2O3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | methyl 3-[[(2S)-2-(3-fluorophenyl)pyrrolidine-1-carbonyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)N1CCC[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C17H17FN2O3S/c1-23-16(21)15-13(7-9-24-15)19-17(22)20-8-3-6-14(20)11-4-2-5-12(18)10-11/h2,4-5,7,9-10,14H,3,6,8H2,1H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | TWVWDTFOIAVCSR-AWEZNQCLSA-N |
| XLogP | 4.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |