C19H21FN2O — CID 50746912
N-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyrrolidine-1-carboxamide (PubChem CID 50746912) has the molecular formula C19H21FN2O and a molecular weight of 312.39 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyrrolidine-1-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 50746912 |
| Molecular Formula | C19H21FN2O |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-(3-fluorophenyl)pyrrolidine-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCCC2c2cccc(F)c2)cc1C |
| InChI | InChI=1S/C19H21FN2O/c1-13-8-9-17(11-14(13)2)21-19(23)22-10-4-7-18(22)15-5-3-6-16(20)12-15/h3,5-6,8-9,11-12,18H,4,7,10H2,1-2H3,(H,21,23) |
| InChIKey | RDIOGNAKBBFZDD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |