C23H27N3O4 — CID 51648656
[(2R)-2-(3-methoxyphenyl)pyrrolidin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone (PubChem CID 51648656) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is [(2R)-2-(3-methoxyphenyl)pyrrolidin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone.
| Compound Name | [(2R)-2-(3-methoxyphenyl)pyrrolidin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 51648656 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | [(2R)-2-(3-methoxyphenyl)pyrrolidin-1-yl]-(3-nitro-4-piperidin-1-ylphenyl)methanone |
| SMILES | COc1cccc([C@H]2CCCN2C(=O)c2ccc(N3CCCCC3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C23H27N3O4/c1-30-19-8-5-7-17(15-19)20-9-6-14-25(20)23(27)18-10-11-21(22(16-18)26(28)29)24-12-3-2-4-13-24/h5,7-8,10-11,15-16,20H,2-4,6,9,12-14H2,1H3/t20-/m1/s1 |
| InChIKey | PSKLWLXTMQZBOE-HXUWFJFHSA-N |
| XLogP | 4.57 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|