C24H28N4O5 — CID 55495228
1-[4-[4-[2-(3-methoxyphenyl)pyrrolidine-1-carbonyl]-2-nitrophenyl]piperazin-1-yl]ethanone (PubChem CID 55495228) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is 1-[4-[4-[2-(3-methoxyphenyl)pyrrolidine-1-carbonyl]-2-nitrophenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[2-(3-methoxyphenyl)pyrrolidine-1-carbonyl]-2-nitrophenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55495228 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 1-[4-[4-[2-(3-methoxyphenyl)pyrrolidine-1-carbonyl]-2-nitrophenyl]piperazin-1-yl]ethanone |
| SMILES | COc1cccc(C2CCCN2C(=O)c2ccc(N3CCN(C(C)=O)CC3)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C24H28N4O5/c1-17(29)25-11-13-26(14-12-25)22-9-8-19(16-23(22)28(31)32)24(30)27-10-4-7-21(27)18-5-3-6-20(15-18)33-2/h3,5-6,8-9,15-16,21H,4,7,10-14H2,1-2H3 |
| InChIKey | BAVGXRPBLFFNDI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 96.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|