C21H24N6O5S — CID 55670396
1-[4-(4-acetylpiperazin-1-yl)-3-nitrobenzoyl]-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 55670396) has the molecular formula C21H24N6O5S and a molecular weight of 472.53 g/mol. Its IUPAC name is 1-[4-(4-acetylpiperazin-1-yl)-3-nitrobenzoyl]-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-[4-(4-acetylpiperazin-1-yl)-3-nitrobenzoyl]-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55670396 |
| Molecular Formula | C21H24N6O5S |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 1-[4-(4-acetylpiperazin-1-yl)-3-nitrobenzoyl]-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N1CCN(c2ccc(C(=O)N3CCCC3C(=O)Nc3nccs3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C21H24N6O5S/c1-14(28)24-8-10-25(11-9-24)16-5-4-15(13-18(16)27(31)32)20(30)26-7-2-3-17(26)19(29)23-21-22-6-12-33-21/h4-6,12-13,17H,2-3,7-11H2,1H3,(H,22,23,29) |
| InChIKey | WQAQJXIGNNTCFW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 128.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|