C16H17N3O2S — CID 46758046
1-(2-methylbenzoyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 46758046) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-(2-methylbenzoyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(2-methylbenzoyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 46758046 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-(2-methylbenzoyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | Cc1ccccc1C(=O)N1CCCC1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C16H17N3O2S/c1-11-5-2-3-6-12(11)15(21)19-9-4-7-13(19)14(20)18-16-17-8-10-22-16/h2-3,5-6,8,10,13H,4,7,9H2,1H3,(H,17,18,20) |
| InChIKey | OLLKCDZIYKKGKT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |