C17H16N4O2S — CID 96569369
(2S)-1-(1H-indole-4-carbonyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide (PubChem CID 96569369) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is (2S)-1-(1H-indole-4-carbonyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(1H-indole-4-carbonyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 96569369 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | (2S)-1-(1H-indole-4-carbonyl)-N-(1,3-thiazol-2-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1nccs1)[C@@H]1CCCN1C(=O)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C17H16N4O2S/c22-15(20-17-19-8-10-24-17)14-5-2-9-21(14)16(23)12-3-1-4-13-11(12)6-7-18-13/h1,3-4,6-8,10,14,18H,2,5,9H2,(H,19,20,22)/t14-/m0/s1 |
| InChIKey | UGXFUYGXUKYGJX-AWEZNQCLSA-N |
| XLogP | 2.87 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |